C7H21N5O3 — CID 121458947
1,1,3,5,7-pentaaminoheptane-2,4,6-triol (PubChem CID 121458947) has the molecular formula C7H21N5O3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 1,1,3,5,7-pentaaminoheptane-2,4,6-triol.
| Compound Name | 1,1,3,5,7-pentaaminoheptane-2,4,6-triol |
|---|---|
| PubChem CID | 121458947 |
| Molecular Formula | C7H21N5O3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1,1,3,5,7-pentaaminoheptane-2,4,6-triol |
| SMILES | NCC(O)C(N)C(O)C(N)C(O)C(N)N |
| InChI | InChI=1S/C7H21N5O3/c8-1-2(13)3(9)5(14)4(10)6(15)7(11)12/h2-7,13-15H,1,8-12H2 |
| InChIKey | ITHXRDKAORITSX-UHFFFAOYSA-N |
| XLogP | -5.07 |
| TPSA | 190.79 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -5.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|