C6H14N2O3 — CID 134382190
4,6-diamino-3,5-dihydroxyhexan-2-one (PubChem CID 134382190) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is 4,6-diamino-3,5-dihydroxyhexan-2-one.
| Compound Name | 4,6-diamino-3,5-dihydroxyhexan-2-one |
|---|---|
| PubChem CID | 134382190 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 4,6-diamino-3,5-dihydroxyhexan-2-one |
| SMILES | CC(=O)C(O)C(N)C(O)CN |
| InChI | InChI=1S/C6H14N2O3/c1-3(9)6(11)5(8)4(10)2-7/h4-6,10-11H,2,7-8H2,1H3 |
| InChIKey | KHGCULUIHSJCTJ-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |