C5H11NO2 — CID 59046379
(3R,4R)-4-amino-3-hydroxypentan-2-one (PubChem CID 59046379) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is (3R,4R)-4-amino-3-hydroxypentan-2-one.
| Compound Name | (3R,4R)-4-amino-3-hydroxypentan-2-one |
|---|---|
| PubChem CID | 59046379 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | (3R,4R)-4-amino-3-hydroxypentan-2-one |
| SMILES | CC(=O)[C@H](O)[C@@H](C)N |
| InChI | InChI=1S/C5H11NO2/c1-3(6)5(8)4(2)7/h3,5,8H,6H2,1-2H3/t3-,5-/m1/s1 |
| InChIKey | HUFAKYNDKPIYQD-NQXXGFSBSA-N |
| XLogP | -0.72 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |