C4H12N2O3 — CID 174289451
acetamide;2-aminoethane-1,1-diol (PubChem CID 174289451) has the molecular formula C4H12N2O3 and a molecular weight of 136.15 g/mol. Its IUPAC name is acetamide;2-aminoethane-1,1-diol.
| Compound Name | acetamide;2-aminoethane-1,1-diol |
|---|---|
| PubChem CID | 174289451 |
| Molecular Formula | C4H12N2O3 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | acetamide;2-aminoethane-1,1-diol |
| SMILES | CC(N)=O.NCC(O)O |
| InChI | InChI=1S/C2H7NO2.C2H5NO/c3-1-2(4)5;1-2(3)4/h2,4-5H,1,3H2;1H3,(H2,3,4) |
| InChIKey | ZAQWERBFBWEUEW-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|