C5H14N2O3 — CID 57298099
1,2-diaminopentane-1,3,5-triol (PubChem CID 57298099) has the molecular formula C5H14N2O3 and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,2-diaminopentane-1,3,5-triol.
| Compound Name | 1,2-diaminopentane-1,3,5-triol |
|---|---|
| PubChem CID | 57298099 |
| Molecular Formula | C5H14N2O3 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 1,2-diaminopentane-1,3,5-triol |
| SMILES | NC(O)C(N)C(O)CCO |
| InChI | InChI=1S/C5H14N2O3/c6-4(5(7)10)3(9)1-2-8/h3-5,8-10H,1-2,6-7H2 |
| InChIKey | JMAKRWGLNUBKDF-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|