C5H14N2O2 — CID 57066183
1,2-diaminopentane-1,3-diol (PubChem CID 57066183) has the molecular formula C5H14N2O2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 1,2-diaminopentane-1,3-diol.
| Compound Name | 1,2-diaminopentane-1,3-diol |
|---|---|
| PubChem CID | 57066183 |
| Molecular Formula | C5H14N2O2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 1,2-diaminopentane-1,3-diol |
| SMILES | CCC(O)C(N)C(N)O |
| InChI | InChI=1S/C5H14N2O2/c1-2-3(8)4(6)5(7)9/h3-5,8-9H,2,6-7H2,1H3 |
| InChIKey | LFVUIAIZBCTAOC-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|