C14H34N2O4 — CID 159063171
2-amino-3-ethylpentane-1,5-diol;4-aminoheptane-3,5-diol (PubChem CID 159063171) has the molecular formula C14H34N2O4 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-amino-3-ethylpentane-1,5-diol;4-aminoheptane-3,5-diol.
| Compound Name | 2-amino-3-ethylpentane-1,5-diol;4-aminoheptane-3,5-diol |
|---|---|
| PubChem CID | 159063171 |
| Molecular Formula | C14H34N2O4 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 2-amino-3-ethylpentane-1,5-diol;4-aminoheptane-3,5-diol |
| SMILES | CCC(CCO)C(N)CO.CCC(O)C(N)C(O)CC |
| InChI | InChI=1S/2C7H17NO2/c1-3-5(9)7(8)6(10)4-2;1-2-6(3-4-9)7(8)5-10/h5-7,9-10H,3-4,8H2,1-2H3;6-7,9-10H,2-5,8H2,1H3 |
| InChIKey | JYSNDEBCMUKPJK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |