C7H17NO2 — CID 10820698
(2S,3R)-2-amino-3-propylbutane-1,4-diol (PubChem CID 10820698) has the molecular formula C7H17NO2 and a molecular weight of 147.22 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-propylbutane-1,4-diol.
| Compound Name | (2S,3R)-2-amino-3-propylbutane-1,4-diol |
|---|---|
| PubChem CID | 10820698 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | (2S,3R)-2-amino-3-propylbutane-1,4-diol |
| SMILES | CCC[C@@H](CO)[C@H](N)CO |
| InChI | InChI=1S/C7H17NO2/c1-2-3-6(4-9)7(8)5-10/h6-7,9-10H,2-5,8H2,1H3/t6-,7+/m0/s1 |
| InChIKey | YVRIJTWZKHKAKH-NKWVEPMBSA-N |
| XLogP | -0.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |