C5H13NO2 — CID 44561573
(2S,3R)-2-aminopentane-1,3-diol (PubChem CID 44561573) has the molecular formula C5H13NO2 and a molecular weight of 119.16 g/mol. Its IUPAC name is (2S,3R)-2-aminopentane-1,3-diol.
| Compound Name | (2S,3R)-2-aminopentane-1,3-diol |
|---|---|
| PubChem CID | 44561573 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | (2S,3R)-2-aminopentane-1,3-diol |
| SMILES | CC[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C5H13NO2/c1-2-5(8)4(6)3-7/h4-5,7-8H,2-3,6H2,1H3/t4-,5+/m0/s1 |
| InChIKey | PJBQQLVBENTUQY-CRCLSJGQSA-N |
| XLogP | -0.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |