C5H13NO2S — CID 86651329
(2S,3R)-2-amino-4-methylsulfanylbutane-1,3-diol (PubChem CID 86651329) has the molecular formula C5H13NO2S and a molecular weight of 151.23 g/mol. Its IUPAC name is (2S,3R)-2-amino-4-methylsulfanylbutane-1,3-diol.
| Compound Name | (2S,3R)-2-amino-4-methylsulfanylbutane-1,3-diol |
|---|---|
| PubChem CID | 86651329 |
| Molecular Formula | C5H13NO2S |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | (2S,3R)-2-amino-4-methylsulfanylbutane-1,3-diol |
| SMILES | CSC[C@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C5H13NO2S/c1-9-3-5(8)4(6)2-7/h4-5,7-8H,2-3,6H2,1H3/t4-,5-/m0/s1 |
| InChIKey | KKBBWCQSDLWOBJ-WHFBIAKZSA-N |
| XLogP | -0.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |