C5H11N3O2S — CID 58158430
(2S,3S)-2-azido-4-methylsulfanylbutane-1,3-diol (PubChem CID 58158430) has the molecular formula C5H11N3O2S and a molecular weight of 177.23 g/mol. Its IUPAC name is (2S,3S)-2-azido-4-methylsulfanylbutane-1,3-diol.
| Compound Name | (2S,3S)-2-azido-4-methylsulfanylbutane-1,3-diol |
|---|---|
| PubChem CID | 58158430 |
| Molecular Formula | C5H11N3O2S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2S,3S)-2-azido-4-methylsulfanylbutane-1,3-diol |
| SMILES | CSC[C@@H](O)[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C5H11N3O2S/c1-11-3-5(10)4(2-9)7-8-6/h4-5,9-10H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | KVVSYNAAFHKWRU-CRCLSJGQSA-N |
| XLogP | 0.38 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|