C8H17N3O4 — CID 10976957
(2S,3R)-2-azido-4,4-diethoxybutane-1,3-diol (PubChem CID 10976957) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2S,3R)-2-azido-4,4-diethoxybutane-1,3-diol.
| Compound Name | (2S,3R)-2-azido-4,4-diethoxybutane-1,3-diol |
|---|---|
| PubChem CID | 10976957 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (2S,3R)-2-azido-4,4-diethoxybutane-1,3-diol |
| SMILES | CCOC(OCC)[C@H](O)[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C8H17N3O4/c1-3-14-8(15-4-2)7(13)6(5-12)10-11-9/h6-8,12-13H,3-5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | DZDJZSNHUBPMPE-NKWVEPMBSA-N |
| XLogP | 0.42 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|