C8H17N3O3 — CID 14604202
3-azido-1,1-diethoxybutan-2-ol (PubChem CID 14604202) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-azido-1,1-diethoxybutan-2-ol.
| Compound Name | 3-azido-1,1-diethoxybutan-2-ol |
|---|---|
| PubChem CID | 14604202 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-azido-1,1-diethoxybutan-2-ol |
| SMILES | CCOC(OCC)C(O)C(C)N=[N+]=[N-] |
| InChI | InChI=1S/C8H17N3O3/c1-4-13-8(14-5-2)7(12)6(3)10-11-9/h6-8,12H,4-5H2,1-3H3 |
| InChIKey | BGNOSSLGWNFXAY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|