C15H29N3O7 — CID 89263192
tert-butyl 2-[(2S)-3-[(1R)-2-azido-1-ethoxypropoxy]-2,4-dihydroxybutoxy]acetate (PubChem CID 89263192) has the molecular formula C15H29N3O7 and a molecular weight of 363.41 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-3-[(1R)-2-azido-1-ethoxypropoxy]-2,4-dihydroxybutoxy]acetate.
| Compound Name | tert-butyl 2-[(2S)-3-[(1R)-2-azido-1-ethoxypropoxy]-2,4-dihydroxybutoxy]acetate |
|---|---|
| PubChem CID | 89263192 |
| Molecular Formula | C15H29N3O7 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | tert-butyl 2-[(2S)-3-[(1R)-2-azido-1-ethoxypropoxy]-2,4-dihydroxybutoxy]acetate |
| SMILES | CCO[C@H](OC(CO)[C@@H](O)COCC(=O)OC(C)(C)C)C(C)N=[N+]=[N-] |
| InChI | InChI=1S/C15H29N3O7/c1-6-23-14(10(2)17-18-16)24-12(7-19)11(20)8-22-9-13(21)25-15(3,4)5/h10-12,14,19-20H,6-9H2,1-5H3/t10?,11-,12?,14+/m0/s1 |
| InChIKey | CESNZBLFGMTCRV-BOLFBJMRSA-N |
| XLogP | 1.14 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|