C18H35N3O6 — CID 135390378
tert-butyl 2-[2-[2-[2-(6-azidohexoxy)ethoxy]ethoxy]ethoxy]acetate (PubChem CID 135390378) has the molecular formula C18H35N3O6 and a molecular weight of 389.49 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-(6-azidohexoxy)ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-(6-azidohexoxy)ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 135390378 |
| Molecular Formula | C18H35N3O6 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-(6-azidohexoxy)ethoxy]ethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C18H35N3O6/c1-18(2,3)27-17(22)16-26-15-14-25-13-12-24-11-10-23-9-7-5-4-6-8-20-21-19/h4-16H2,1-3H3 |
| InChIKey | SJXWBMRBUGJIOY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|