C15H28N4O5 — CID 168833005
2-[4-(4-azidobutoxy)butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid (PubChem CID 168833005) has the molecular formula C15H28N4O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[4-(4-azidobutoxy)butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid.
| Compound Name | 2-[4-(4-azidobutoxy)butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 168833005 |
| Molecular Formula | C15H28N4O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-[4-(4-azidobutoxy)butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
| SMILES | CC(C)(C)OC(=O)N(CCCCOCCCCN=[N+]=[N-])CC(=O)O |
| InChI | InChI=1S/C15H28N4O5/c1-15(2,3)24-14(22)19(12-13(20)21)9-5-7-11-23-10-6-4-8-17-18-16/h4-12H2,1-3H3,(H,20,21) |
| InChIKey | LMYRPWWOANKVGB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|