C13H25N5O4 — CID 162489554
2-[2-[3-azidopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl-methylamino]acetic acid (PubChem CID 162489554) has the molecular formula C13H25N5O4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[2-[3-azidopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl-methylamino]acetic acid.
| Compound Name | 2-[2-[3-azidopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 162489554 |
| Molecular Formula | C13H25N5O4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-[2-[3-azidopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl-methylamino]acetic acid |
| SMILES | CN(CCN(CCCN=[N+]=[N-])C(=O)OC(C)(C)C)CC(=O)O |
| InChI | InChI=1S/C13H25N5O4/c1-13(2,3)22-12(21)18(7-5-6-15-16-14)9-8-17(4)10-11(19)20/h5-10H2,1-4H3,(H,19,20) |
| InChIKey | CFGVFHWQJTUUFL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|