C17H32N4O7 — CID 162489611
methyl 3-[2-[2-[2-[2-azidoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 162489611) has the molecular formula C17H32N4O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is methyl 3-[2-[2-[2-[2-azidoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | methyl 3-[2-[2-[2-[2-azidoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 162489611 |
| Molecular Formula | C17H32N4O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | methyl 3-[2-[2-[2-[2-azidoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | COC(=O)CCOCCOCCOCCN(CCN=[N+]=[N-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32N4O7/c1-17(2,3)28-16(23)21(7-6-19-20-18)8-10-26-12-14-27-13-11-25-9-5-15(22)24-4/h5-14H2,1-4H3 |
| InChIKey | RDSNDUWRMCQPMT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 132.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|