C11H22N4O3 — CID 166715036
tert-butyl N-[2-(2-azidoethoxy)ethyl]-N-ethylcarbamate (PubChem CID 166715036) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is tert-butyl N-[2-(2-azidoethoxy)ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-(2-azidoethoxy)ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 166715036 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | tert-butyl N-[2-(2-azidoethoxy)ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCOCCN=[N+]=[N-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N4O3/c1-5-15(10(16)18-11(2,3)4)7-9-17-8-6-13-14-12/h5-9H2,1-4H3 |
| InChIKey | RFMVTINJAFJSSL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|