C12H22N4O5 — CID 162489373
methyl 2-[2-(2-azidoethoxy)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate (PubChem CID 162489373) has the molecular formula C12H22N4O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl 2-[2-(2-azidoethoxy)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate.
| Compound Name | methyl 2-[2-(2-azidoethoxy)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate |
|---|---|
| PubChem CID | 162489373 |
| Molecular Formula | C12H22N4O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | methyl 2-[2-(2-azidoethoxy)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate |
| SMILES | COC(=O)CN(CCOCCN=[N+]=[N-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N4O5/c1-12(2,3)21-11(18)16(9-10(17)19-4)6-8-20-7-5-14-15-13/h5-9H2,1-4H3 |
| InChIKey | XPSLKWUQALESGI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|