C11H23N3O3 — CID 102452687
2-(6-azidohexoxymethyl)-2-methylpropane-1,3-diol (PubChem CID 102452687) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-(6-azidohexoxymethyl)-2-methylpropane-1,3-diol.
| Compound Name | 2-(6-azidohexoxymethyl)-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 102452687 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 2-(6-azidohexoxymethyl)-2-methylpropane-1,3-diol |
| SMILES | CC(CO)(CO)COCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C11H23N3O3/c1-11(8-15,9-16)10-17-7-5-3-2-4-6-13-14-12/h15-16H,2-10H2,1H3 |
| InChIKey | UQMPLWSHIDLYRI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|