C27H54O9 — CID 160990095
tert-butyl 2-[5-(2-hydroxyethoxy)pentoxy]acetate;tert-butyl 2-(5-propoxypentoxy)acetate (PubChem CID 160990095) has the molecular formula C27H54O9 and a molecular weight of 522.72 g/mol. Its IUPAC name is tert-butyl 2-[5-(2-hydroxyethoxy)pentoxy]acetate;tert-butyl 2-(5-propoxypentoxy)acetate.
| Compound Name | tert-butyl 2-[5-(2-hydroxyethoxy)pentoxy]acetate;tert-butyl 2-(5-propoxypentoxy)acetate |
|---|---|
| PubChem CID | 160990095 |
| Molecular Formula | C27H54O9 |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.38 |
| IUPAC Name | tert-butyl 2-[5-(2-hydroxyethoxy)pentoxy]acetate;tert-butyl 2-(5-propoxypentoxy)acetate |
| SMILES | CC(C)(C)OC(=O)COCCCCCOCCO.CCCOCCCCCOCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28O4.C13H26O5/c1-5-9-16-10-7-6-8-11-17-12-13(15)18-14(2,3)4;1-13(2,3)18-12(15)11-17-9-6-4-5-8-16-10-7-14/h5-12H2,1-4H3;14H,4-11H2,1-3H3 |
| InChIKey | TUMUKSKWKKPBPO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|