C8H13N6NaO4 — CID 157049531
sodium;(2S)-2-azido-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;azide (PubChem CID 157049531) has the molecular formula C8H13N6NaO4 and a molecular weight of 280.22 g/mol. Its IUPAC name is sodium;(2S)-2-azido-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;azide.
| Compound Name | sodium;(2S)-2-azido-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;azide |
|---|---|
| PubChem CID | 157049531 |
| Molecular Formula | C8H13N6NaO4 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | sodium;(2S)-2-azido-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;azide |
| SMILES | CC(C)(C)OC(=O)C[C@H](N=[N+]=[N-])C(=O)O.[N-]=[N+]=[N-].[Na+] |
| InChI | InChI=1S/C8H13N3O4.N3.Na/c1-8(2,3)15-6(12)4-5(7(13)14)10-11-9;1-3-2;/h5H,4H2,1-3H3,(H,13,14);;/q;-1;+1/t5-;;/m0../s1 |
| InChIKey | BRGUVLPPQRJJGC-XRIGFGBMSA-N |
| XLogP | -0.65 |
| TPSA | 171.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|