C30H52N12O12 — CID 123238672
2-azido-5-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4,4-dimethyl-5-oxopentanoic acid;1-O-[2-[2-(2-azidoethoxy)ethoxy]ethyl] 5-O-tert-butyl 4-azido-2,2-dimethylpentanedioate (PubChem CID 123238672) has the molecular formula C30H52N12O12 and a molecular weight of 772.82 g/mol. Its IUPAC name is 2-azido-5-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4,4-dimethyl-5-oxopentanoic acid;1-O-[2-[2-(2-azidoethoxy)ethoxy]ethyl] 5-O-tert-butyl 4-azido-2,2-dimethylpentanedioate.
| Compound Name | 2-azido-5-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4,4-dimethyl-5-oxopentanoic acid;1-O-[2-[2-(2-azidoethoxy)ethoxy]ethyl] 5-O-tert-butyl 4-azido-2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 123238672 |
| Molecular Formula | C30H52N12O12 |
| Molecular Weight | 772.82 g/mol |
| Exact Mass | 772.38 |
| IUPAC Name | 2-azido-5-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4,4-dimethyl-5-oxopentanoic acid;1-O-[2-[2-(2-azidoethoxy)ethoxy]ethyl] 5-O-tert-butyl 4-azido-2,2-dimethylpentanedioate |
| SMILES | CC(C)(C)OC(=O)C(CC(C)(C)C(=O)OCCOCCOCCN=[N+]=[N-])N=[N+]=[N-].CC(C)(CC(N=[N+]=[N-])C(=O)O)C(=O)OCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C17H30N6O6.C13H22N6O6/c1-16(2,3)29-14(24)13(21-23-19)12-17(4,5)15(25)28-11-10-27-9-8-26-7-6-20-22-18;1-13(2,9-10(11(20)21)17-19-15)12(22)25-8-7-24-6-5-23-4-3-16-18-14/h13H,6-12H2,1-5H3;10H,3-9H2,1-2H3,(H,20,21) |
| InChIKey | CEXJANFVUXAMLH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 348.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.82 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|