C11H19N3O8P+ — CID 90349128
2-[4-azido-5-(2-hydroxyethoxy)-2,2-dimethyl-5-oxopentanoyl]oxyethoxy-hydroxy-oxophosphanium (PubChem CID 90349128) has the molecular formula C11H19N3O8P+ and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-[4-azido-5-(2-hydroxyethoxy)-2,2-dimethyl-5-oxopentanoyl]oxyethoxy-hydroxy-oxophosphanium.
| Compound Name | 2-[4-azido-5-(2-hydroxyethoxy)-2,2-dimethyl-5-oxopentanoyl]oxyethoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90349128 |
| Molecular Formula | C11H19N3O8P+ |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[4-azido-5-(2-hydroxyethoxy)-2,2-dimethyl-5-oxopentanoyl]oxyethoxy-hydroxy-oxophosphanium |
| SMILES | CC(C)(CC(N=[N+]=[N-])C(=O)OCCO)C(=O)OCCO[P+](=O)O |
| InChI | InChI=1S/C11H18N3O8P/c1-11(2,10(17)21-5-6-22-23(18)19)7-8(13-14-12)9(16)20-4-3-15/h8,15H,3-7H2,1-2H3/p+1 |
| InChIKey | UJCZGROHHUUBLY-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 168.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|