C24H33F12O11P — CID 59018759
1-O-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) 5-O-(2-hydroxyethyl) 3-O-(2-phosphonooxyethyl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 59018759) has the molecular formula C24H33F12O11P and a molecular weight of 756.47 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) 5-O-(2-hydroxyethyl) 3-O-(2-phosphonooxyethyl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) 5-O-(2-hydroxyethyl) 3-O-(2-phosphonooxyethyl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59018759 |
| Molecular Formula | C24H33F12O11P |
| Molecular Weight | 756.47 g/mol |
| Exact Mass | 756.16 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) 5-O-(2-hydroxyethyl) 3-O-(2-phosphonooxyethyl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(CC(C)(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)OCCOP(=O)(O)O)C(=O)OCCO |
| InChI | InChI=1S/C24H33F12O11P/c1-5-19(4,17(40)45-7-6-37)11-13(14(38)44-8-9-47-48(41,42)43)10-18(2,3)16(39)46-12-20(27,28)22(31,32)24(35,36)23(33,34)21(29,30)15(25)26/h13,15,37H,5-12H2,1-4H3,(H2,41,42,43) |
| InChIKey | AYPKWEDWHWMZQM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|