C32H38F12O12S — CID 59017702
1-O-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) 3-O-(2-hydroxyethyl) 5-O-[2-[2-(trioxidanylsulfanyl)benzoyl]oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 59017702) has the molecular formula C32H38F12O12S and a molecular weight of 874.69 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) 3-O-(2-hydroxyethyl) 5-O-[2-[2-(trioxidanylsulfanyl)benzoyl]oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) 3-O-(2-hydroxyethyl) 5-O-[2-[2-(trioxidanylsulfanyl)benzoyl]oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59017702 |
| Molecular Formula | C32H38F12O12S |
| Molecular Weight | 874.69 g/mol |
| Exact Mass | 874.19 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) 3-O-(2-hydroxyethyl) 5-O-[2-[2-(trioxidanylsulfanyl)benzoyl]oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)OCCO)C(=O)OCCOC(=O)c1ccccc1SOOO |
| InChI | InChI=1S/C32H38F12O12S/c1-6-26(4,23(48)53-14-13-51-20(46)18-9-7-8-10-19(18)57-56-55-50)16-27(5,24(49)52-12-11-45)15-25(2,3)22(47)54-17-28(35,36)30(39,40)32(43,44)31(41,42)29(37,38)21(33)34/h7-10,21,45,50H,6,11-17H2,1-5H3 |
| InChIKey | GTIGSNSLQKOSHU-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.69 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|