C47H54F3NO11 — CID 155766236
1-O-[2-[3-hydroxy-4-(trityloxycarbamoyl)phenoxy]ethyl] 5-O-(2-methoxyethyl) 3-O-(2,2,2-trifluoroethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 155766236) has the molecular formula C47H54F3NO11 and a molecular weight of 865.94 g/mol. Its IUPAC name is 1-O-[2-[3-hydroxy-4-(trityloxycarbamoyl)phenoxy]ethyl] 5-O-(2-methoxyethyl) 3-O-(2,2,2-trifluoroethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-[2-[3-hydroxy-4-(trityloxycarbamoyl)phenoxy]ethyl] 5-O-(2-methoxyethyl) 3-O-(2,2,2-trifluoroethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 155766236 |
| Molecular Formula | C47H54F3NO11 |
| Molecular Weight | 865.94 g/mol |
| Exact Mass | 865.36 |
| IUPAC Name | 1-O-[2-[3-hydroxy-4-(trityloxycarbamoyl)phenoxy]ethyl] 5-O-(2-methoxyethyl) 3-O-(2,2,2-trifluoroethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OCCOc1ccc(C(=O)NOC(c2ccccc2)(c2ccccc2)c2ccccc2)c(O)c1)C(=O)OCC(F)(F)F)C(=O)OCCOC |
| InChI | InChI=1S/C47H54F3NO11/c1-7-44(4,41(55)60-26-25-57-6)31-45(5,42(56)61-32-46(48,49)50)30-43(2,3)40(54)59-28-27-58-36-23-24-37(38(52)29-36)39(53)51-62-47(33-17-11-8-12-18-33,34-19-13-9-14-20-34)35-21-15-10-16-22-35/h8-24,29,52H,7,25-28,30-32H2,1-6H3,(H,51,53) |
| InChIKey | KHDTUVCYWNJURP-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.94 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|