C28H34O6S — CID 175630871
1-O-[2-(4-benzoylphenoxy)ethyl] 5-O-(thiiran-2-ylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 175630871) has the molecular formula C28H34O6S and a molecular weight of 498.64 g/mol. Its IUPAC name is 1-O-[2-(4-benzoylphenoxy)ethyl] 5-O-(thiiran-2-ylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-(4-benzoylphenoxy)ethyl] 5-O-(thiiran-2-ylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 175630871 |
| Molecular Formula | C28H34O6S |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 1-O-[2-(4-benzoylphenoxy)ethyl] 5-O-(thiiran-2-ylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC1CS1)C(=O)OCCOc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H34O6S/c1-5-28(4,19-27(2,3)25(30)34-17-23-18-35-23)26(31)33-16-15-32-22-13-11-21(12-14-22)24(29)20-9-7-6-8-10-20/h6-14,23H,5,15-19H2,1-4H3 |
| InChIKey | IIDBDCGVCPTRGQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|