C33H41I3O9 — CID 171726420
3-O-tert-butyl 1-O-(4-hydroxyphenyl) 5-O-[2-(2,3,5-triiodobenzoyl)oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 171726420) has the molecular formula C33H41I3O9 and a molecular weight of 962.39 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-(4-hydroxyphenyl) 5-O-[2-(2,3,5-triiodobenzoyl)oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-tert-butyl 1-O-(4-hydroxyphenyl) 5-O-[2-(2,3,5-triiodobenzoyl)oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 171726420 |
| Molecular Formula | C33H41I3O9 |
| Molecular Weight | 962.39 g/mol |
| Exact Mass | 961.99 |
| IUPAC Name | 3-O-tert-butyl 1-O-(4-hydroxyphenyl) 5-O-[2-(2,3,5-triiodobenzoyl)oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)Oc1ccc(O)cc1)C(=O)OC(C)(C)C)C(=O)OCCOC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C33H41I3O9/c1-9-32(7,28(40)43-15-14-42-26(38)23-16-20(34)17-24(35)25(23)36)19-33(8,29(41)45-30(2,3)4)18-31(5,6)27(39)44-22-12-10-21(37)11-13-22/h10-13,16-17,37H,9,14-15,18-19H2,1-8H3 |
| InChIKey | UXZFLMOUEODSSA-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.39 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|