C32H46O7S4 — CID 118530772
3-O-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]ethyl] 1-O-(4-methylsulfanylphenyl) 5-O-(thiophen-2-ylmethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 118530772) has the molecular formula C32H46O7S4 and a molecular weight of 670.98 g/mol. Its IUPAC name is 3-O-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]ethyl] 1-O-(4-methylsulfanylphenyl) 5-O-(thiophen-2-ylmethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]ethyl] 1-O-(4-methylsulfanylphenyl) 5-O-(thiophen-2-ylmethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 118530772 |
| Molecular Formula | C32H46O7S4 |
| Molecular Weight | 670.98 g/mol |
| Exact Mass | 670.21 |
| IUPAC Name | 3-O-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]ethyl] 1-O-(4-methylsulfanylphenyl) 5-O-(thiophen-2-ylmethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)Oc1ccc(SC)cc1)C(=O)OCCSCCSCCO)C(=O)OCc1cccs1 |
| InChI | InChI=1S/C32H46O7S4/c1-7-31(4,28(35)38-21-26-9-8-16-43-26)23-32(5,29(36)37-15-18-42-20-19-41-17-14-33)22-30(2,3)27(34)39-24-10-12-25(40-6)13-11-24/h8-13,16,33H,7,14-15,17-23H2,1-6H3 |
| InChIKey | SZOWOENHBISIKX-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.98 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|