C43H62O13 — CID 118052116
6-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxycarbonyl]-2-ethyl-2,4,6,8-tetramethyl-8-(2-methyl-2-phenoxycarbonylbutyl)-4-phenoxycarbonylnonanedioic acid (PubChem CID 118052116) has the molecular formula C43H62O13 and a molecular weight of 786.96 g/mol. Its IUPAC name is 6-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxycarbonyl]-2-ethyl-2,4,6,8-tetramethyl-8-(2-methyl-2-phenoxycarbonylbutyl)-4-phenoxycarbonylnonanedioic acid.
| Compound Name | 6-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxycarbonyl]-2-ethyl-2,4,6,8-tetramethyl-8-(2-methyl-2-phenoxycarbonylbutyl)-4-phenoxycarbonylnonanedioic acid |
|---|---|
| PubChem CID | 118052116 |
| Molecular Formula | C43H62O13 |
| Molecular Weight | 786.96 g/mol |
| Exact Mass | 786.42 |
| IUPAC Name | 6-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxycarbonyl]-2-ethyl-2,4,6,8-tetramethyl-8-(2-methyl-2-phenoxycarbonylbutyl)-4-phenoxycarbonylnonanedioic acid |
| SMILES | CCOCCOCCOCCOC(=O)C(C)(CC(C)(CC(C)(CC)C(=O)Oc1ccccc1)C(=O)O)CC(C)(CC(C)(CC)C(=O)O)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C43H62O13/c1-9-39(4,34(44)45)28-43(8,38(50)56-33-20-16-13-17-21-33)31-42(7,36(48)54-27-26-53-25-24-52-23-22-51-11-3)30-41(6,35(46)47)29-40(5,10-2)37(49)55-32-18-14-12-15-19-32/h12-21H,9-11,22-31H2,1-8H3,(H,44,45)(H,46,47) |
| InChIKey | MJIVDPADCBUXGR-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.96 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|