C14H26O6 — CID 101278782
bis(2-ethoxyethyl) 2-ethyl-2-methylpropanedioate (PubChem CID 101278782) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is bis(2-ethoxyethyl) 2-ethyl-2-methylpropanedioate.
| Compound Name | bis(2-ethoxyethyl) 2-ethyl-2-methylpropanedioate |
|---|---|
| PubChem CID | 101278782 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | bis(2-ethoxyethyl) 2-ethyl-2-methylpropanedioate |
| SMILES | CCOCCOC(=O)C(C)(CC)C(=O)OCCOCC |
| InChI | InChI=1S/C14H26O6/c1-5-14(4,12(15)19-10-8-17-6-2)13(16)20-11-9-18-7-3/h5-11H2,1-4H3 |
| InChIKey | IRIUJFAQRBQHDJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|