C12H22O4 — CID 57075664
2-ethoxyethyl 2-formyl-2,4-dimethylpentanoate (PubChem CID 57075664) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-ethoxyethyl 2-formyl-2,4-dimethylpentanoate.
| Compound Name | 2-ethoxyethyl 2-formyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 57075664 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-ethoxyethyl 2-formyl-2,4-dimethylpentanoate |
| SMILES | CCOCCOC(=O)C(C)(C=O)CC(C)C |
| InChI | InChI=1S/C12H22O4/c1-5-15-6-7-16-11(14)12(4,9-13)8-10(2)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | NFNSNXCULCWJBG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|