C21H28O7 — CID 175311006
2-ethoxyethyl 2-methylprop-2-enoate;phenyl 2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 175311006) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-ethoxyethyl 2-methylprop-2-enoate;phenyl 2-methylprop-2-enoate;prop-2-enoic acid.
| Compound Name | 2-ethoxyethyl 2-methylprop-2-enoate;phenyl 2-methylprop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 175311006 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-ethoxyethyl 2-methylprop-2-enoate;phenyl 2-methylprop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCOCC.C=C(C)C(=O)Oc1ccccc1.C=CC(=O)O |
| InChI | InChI=1S/C10H10O2.C8H14O3.C3H4O2/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-4-10-5-6-11-8(9)7(2)3;1-2-3(4)5/h3-7H,1H2,2H3;2,4-6H2,1,3H3;2H,1H2,(H,4,5) |
| InChIKey | FZUSBYNKDJAVFQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|