C21H25Cl2NO5 — CID 54138960
1-O-(5,7-dichloroquinolin-8-yl) 5-O-(2-hydroxyethyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 54138960) has the molecular formula C21H25Cl2NO5 and a molecular weight of 442.34 g/mol. Its IUPAC name is 1-O-(5,7-dichloroquinolin-8-yl) 5-O-(2-hydroxyethyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-(5,7-dichloroquinolin-8-yl) 5-O-(2-hydroxyethyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 54138960 |
| Molecular Formula | C21H25Cl2NO5 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 1-O-(5,7-dichloroquinolin-8-yl) 5-O-(2-hydroxyethyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)Oc1c(Cl)cc(Cl)c2cccnc12)C(=O)OCCO |
| InChI | InChI=1S/C21H25Cl2NO5/c1-5-21(4,19(27)28-10-9-25)12-20(2,3)18(26)29-17-15(23)11-14(22)13-7-6-8-24-16(13)17/h6-8,11,25H,5,9-10,12H2,1-4H3 |
| InChIKey | NZSPNKQJZQJCLU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|