C17H18Cl2N2O2 — CID 2929651
(5,7-dichloroquinolin-8-yl) 2-ethylpiperidine-1-carboxylate (PubChem CID 2929651) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is (5,7-dichloroquinolin-8-yl) 2-ethylpiperidine-1-carboxylate.
| Compound Name | (5,7-dichloroquinolin-8-yl) 2-ethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 2929651 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (5,7-dichloroquinolin-8-yl) 2-ethylpiperidine-1-carboxylate |
| SMILES | CCC1CCCCN1C(=O)Oc1c(Cl)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-2-11-6-3-4-9-21(11)17(22)23-16-14(19)10-13(18)12-7-5-8-20-15(12)16/h5,7-8,10-11H,2-4,6,9H2,1H3 |
| InChIKey | JISGYVJAGUQLFI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |