C14H18Cl2N2O — CID 108990919
N-(2,6-dichlorophenyl)-2-ethylpiperidine-1-carboxamide (PubChem CID 108990919) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-ethylpiperidine-1-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-ethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 108990919 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-ethylpiperidine-1-carboxamide |
| SMILES | CCC1CCCCN1C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O/c1-2-10-6-3-4-9-18(10)14(19)17-13-11(15)7-5-8-12(13)16/h5,7-8,10H,2-4,6,9H2,1H3,(H,17,19) |
| InChIKey | ONLJWXFYPZRKEJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |