C14H19ClN2O3S — CID 97291407
4-[[(2S)-2-ethylpiperidine-1-carbonyl]amino]benzenesulfonyl chloride (PubChem CID 97291407) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 4-[[(2S)-2-ethylpiperidine-1-carbonyl]amino]benzenesulfonyl chloride.
| Compound Name | 4-[[(2S)-2-ethylpiperidine-1-carbonyl]amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 97291407 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-[[(2S)-2-ethylpiperidine-1-carbonyl]amino]benzenesulfonyl chloride |
| SMILES | CC[C@H]1CCCCN1C(=O)Nc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O3S/c1-2-12-5-3-4-10-17(12)14(18)16-11-6-8-13(9-7-11)21(15,19)20/h6-9,12H,2-5,10H2,1H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | AJQIZDDVUOOLBC-LBPRGKRZSA-N |
| XLogP | 3.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |