C17H21ClN2O3 — CID 110002595
2-(5-chloroquinolin-8-yl)oxy-N-(1-hydroxy-3-methylpentan-3-yl)acetamide (PubChem CID 110002595) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 2-(5-chloroquinolin-8-yl)oxy-N-(1-hydroxy-3-methylpentan-3-yl)acetamide.
| Compound Name | 2-(5-chloroquinolin-8-yl)oxy-N-(1-hydroxy-3-methylpentan-3-yl)acetamide |
|---|---|
| PubChem CID | 110002595 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-(5-chloroquinolin-8-yl)oxy-N-(1-hydroxy-3-methylpentan-3-yl)acetamide |
| SMILES | CCC(C)(CCO)NC(=O)COc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C17H21ClN2O3/c1-3-17(2,8-10-21)20-15(22)11-23-14-7-6-13(18)12-5-4-9-19-16(12)14/h4-7,9,21H,3,8,10-11H2,1-2H3,(H,20,22) |
| InChIKey | BMFFLJKLNZXYTL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |