C15H15ClINO2 — CID 24578624
1-(5-chloro-7-iodoquinolin-8-yl)oxy-3,3-dimethylbutan-2-one (PubChem CID 24578624) has the molecular formula C15H15ClINO2 and a molecular weight of 403.65 g/mol. Its IUPAC name is 1-(5-chloro-7-iodoquinolin-8-yl)oxy-3,3-dimethylbutan-2-one.
| Compound Name | 1-(5-chloro-7-iodoquinolin-8-yl)oxy-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 24578624 |
| Molecular Formula | C15H15ClINO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 1-(5-chloro-7-iodoquinolin-8-yl)oxy-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)COc1c(I)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C15H15ClINO2/c1-15(2,3)12(19)8-20-14-11(17)7-10(16)9-5-4-6-18-13(9)14/h4-7H,8H2,1-3H3 |
| InChIKey | HOAQHMKUJVKGCC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|