C17H14ClIN2O2 — CID 24623003
2-(5-chloro-7-iodoquinolin-8-yl)oxy-1-(2,5-dimethyl-1H-pyrrol-3-yl)ethanone (PubChem CID 24623003) has the molecular formula C17H14ClIN2O2 and a molecular weight of 440.67 g/mol. Its IUPAC name is 2-(5-chloro-7-iodoquinolin-8-yl)oxy-1-(2,5-dimethyl-1H-pyrrol-3-yl)ethanone.
| Compound Name | 2-(5-chloro-7-iodoquinolin-8-yl)oxy-1-(2,5-dimethyl-1H-pyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 24623003 |
| Molecular Formula | C17H14ClIN2O2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 2-(5-chloro-7-iodoquinolin-8-yl)oxy-1-(2,5-dimethyl-1H-pyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)COc2c(I)cc(Cl)c3cccnc23)c(C)[nH]1 |
| InChI | InChI=1S/C17H14ClIN2O2/c1-9-6-12(10(2)21-9)15(22)8-23-17-14(19)7-13(18)11-4-3-5-20-16(11)17/h3-7,21H,8H2,1-2H3 |
| InChIKey | NMKHYABVNHJRBT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|