C17H18ClIN2O4 — CID 42971775
[2-(butan-2-ylamino)-2-oxoethyl] 2-(5-chloro-7-iodoquinolin-8-yl)oxyacetate (PubChem CID 42971775) has the molecular formula C17H18ClIN2O4 and a molecular weight of 476.70 g/mol. Its IUPAC name is [2-(butan-2-ylamino)-2-oxoethyl] 2-(5-chloro-7-iodoquinolin-8-yl)oxyacetate.
| Compound Name | [2-(butan-2-ylamino)-2-oxoethyl] 2-(5-chloro-7-iodoquinolin-8-yl)oxyacetate |
|---|---|
| PubChem CID | 42971775 |
| Molecular Formula | C17H18ClIN2O4 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | [2-(butan-2-ylamino)-2-oxoethyl] 2-(5-chloro-7-iodoquinolin-8-yl)oxyacetate |
| SMILES | CCC(C)NC(=O)COC(=O)COc1c(I)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C17H18ClIN2O4/c1-3-10(2)21-14(22)8-24-15(23)9-25-17-13(19)7-12(18)11-5-4-6-20-16(11)17/h4-7,10H,3,8-9H2,1-2H3,(H,21,22) |
| InChIKey | WJGMBFWOAXBMHT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|