C15H19I2NO4 — CID 154589793
2-(2,2-dimethylbutanoyloxy)ethyl 2-amino-3,5-diiodobenzoate (PubChem CID 154589793) has the molecular formula C15H19I2NO4 and a molecular weight of 531.13 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl 2-amino-3,5-diiodobenzoate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl 2-amino-3,5-diiodobenzoate |
|---|---|
| PubChem CID | 154589793 |
| Molecular Formula | C15H19I2NO4 |
| Molecular Weight | 531.13 g/mol |
| Exact Mass | 530.94 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl 2-amino-3,5-diiodobenzoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)c1cc(I)cc(I)c1N |
| InChI | InChI=1S/C15H19I2NO4/c1-4-15(2,3)14(20)22-6-5-21-13(19)10-7-9(16)8-11(17)12(10)18/h7-8H,4-6,18H2,1-3H3 |
| InChIKey | JJBVPRXJOLOJNT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.13 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|