C21H22O8 — CID 58705002
6-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]naphthalene-2,3-dicarboxylic acid (PubChem CID 58705002) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 6-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]naphthalene-2,3-dicarboxylic acid.
| Compound Name | 6-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]naphthalene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 58705002 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 6-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]naphthalene-2,3-dicarboxylic acid |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)c1ccc2cc(C(=O)O)c(C(=O)O)cc2c1 |
| InChI | InChI=1S/C21H22O8/c1-4-21(2,3)20(27)29-8-7-28-19(26)13-6-5-12-10-15(17(22)23)16(18(24)25)11-14(12)9-13/h5-6,9-11H,4,7-8H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | HZLXFWWGPUMJJE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|