C28H44ClNO10 — CID 91349288
4-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]phthalic acid;2-(2,2-dimethylbutanoyloxy)ethyl-trimethylazanium;chloride (PubChem CID 91349288) has the molecular formula C28H44ClNO10 and a molecular weight of 590.11 g/mol. Its IUPAC name is 4-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]phthalic acid;2-(2,2-dimethylbutanoyloxy)ethyl-trimethylazanium;chloride.
| Compound Name | 4-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]phthalic acid;2-(2,2-dimethylbutanoyloxy)ethyl-trimethylazanium;chloride |
|---|---|
| PubChem CID | 91349288 |
| Molecular Formula | C28H44ClNO10 |
| Molecular Weight | 590.11 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 4-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]phthalic acid;2-(2,2-dimethylbutanoyloxy)ethyl-trimethylazanium;chloride |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)c1ccc(C(=O)O)c(C(=O)O)c1.CCC(C)(C)C(=O)OCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C17H20O8.C11H24NO2.ClH/c1-4-17(2,3)16(23)25-8-7-24-15(22)10-5-6-11(13(18)19)12(9-10)14(20)21;1-7-11(2,3)10(13)14-9-8-12(4,5)6;/h5-6,9H,4,7-8H2,1-3H3,(H,18,19)(H,20,21);7-9H2,1-6H3;1H/q;+1;/p-1 |
| InChIKey | LEDXXGPBTHNHOQ-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.11 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|