C32H43NO14 — CID 91388751
2-[2-(2,2-dimethylbutanoyloxy)ethylperoxymethyl]pyridine-3-carboxylic acid;2-[2-(2,2-dimethylbutanoyloxy)ethylperoxymethyl]terephthalic acid (PubChem CID 91388751) has the molecular formula C32H43NO14 and a molecular weight of 665.69 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylbutanoyloxy)ethylperoxymethyl]pyridine-3-carboxylic acid;2-[2-(2,2-dimethylbutanoyloxy)ethylperoxymethyl]terephthalic acid.
| Compound Name | 2-[2-(2,2-dimethylbutanoyloxy)ethylperoxymethyl]pyridine-3-carboxylic acid;2-[2-(2,2-dimethylbutanoyloxy)ethylperoxymethyl]terephthalic acid |
|---|---|
| PubChem CID | 91388751 |
| Molecular Formula | C32H43NO14 |
| Molecular Weight | 665.69 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | 2-[2-(2,2-dimethylbutanoyloxy)ethylperoxymethyl]pyridine-3-carboxylic acid;2-[2-(2,2-dimethylbutanoyloxy)ethylperoxymethyl]terephthalic acid |
| SMILES | CCC(C)(C)C(=O)OCCOOCc1cc(C(=O)O)ccc1C(=O)O.CCC(C)(C)C(=O)OCCOOCc1ncccc1C(=O)O |
| InChI | InChI=1S/C17H22O8.C15H21NO6/c1-4-17(2,3)16(22)23-7-8-24-25-10-12-9-11(14(18)19)5-6-13(12)15(20)21;1-4-15(2,3)14(19)20-8-9-21-22-10-12-11(13(17)18)6-5-7-16-12/h5-6,9H,4,7-8,10H2,1-3H3,(H,18,19)(H,20,21);5-7H,4,8-10H2,1-3H3,(H,17,18) |
| InChIKey | BBIFSUGVUXZPQE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 214.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|