C23H32O8 — CID 122576955
4-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethoxycarbonyl]phthalic acid (PubChem CID 122576955) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is 4-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethoxycarbonyl]phthalic acid.
| Compound Name | 4-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethoxycarbonyl]phthalic acid |
|---|---|
| PubChem CID | 122576955 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 4-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethoxycarbonyl]phthalic acid |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCOC(=O)c1ccc(C(=O)O)c(C(=O)O)c1)C(C)(C)C |
| InChI | InChI=1S/C23H32O8/c1-21(2,3)13-23(7,22(4,5)6)20(29)31-11-10-30-19(28)14-8-9-15(17(24)25)16(12-14)18(26)27/h8-9,12H,10-11,13H2,1-7H3,(H,24,25)(H,26,27) |
| InChIKey | OTHQRIQZQNSWRP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|