C14H15I3O4 — CID 159661786
(4-oxo-4-propoxybutyl) 2,3,5-triiodobenzoate (PubChem CID 159661786) has the molecular formula C14H15I3O4 and a molecular weight of 627.98 g/mol. Its IUPAC name is (4-oxo-4-propoxybutyl) 2,3,5-triiodobenzoate.
| Compound Name | (4-oxo-4-propoxybutyl) 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 159661786 |
| Molecular Formula | C14H15I3O4 |
| Molecular Weight | 627.98 g/mol |
| Exact Mass | 627.81 |
| IUPAC Name | (4-oxo-4-propoxybutyl) 2,3,5-triiodobenzoate |
| SMILES | CCCOC(=O)CCCOC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C14H15I3O4/c1-2-5-20-12(18)4-3-6-21-14(19)10-7-9(15)8-11(16)13(10)17/h7-8H,2-6H2,1H3 |
| InChIKey | YOJVGKVLPFNBNN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|