C7H5I3N2O — CID 15515243
2,3,5-triiodobenzohydrazide (PubChem CID 15515243) has the molecular formula C7H5I3N2O and a molecular weight of 513.84 g/mol. Its IUPAC name is 2,3,5-triiodobenzohydrazide.
| Compound Name | 2,3,5-triiodobenzohydrazide |
|---|---|
| PubChem CID | 15515243 |
| Molecular Formula | C7H5I3N2O |
| Molecular Weight | 513.84 g/mol |
| Exact Mass | 513.75 |
| IUPAC Name | 2,3,5-triiodobenzohydrazide |
| SMILES | NNC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C7H5I3N2O/c8-3-1-4(7(13)12-11)6(10)5(9)2-3/h1-2H,11H2,(H,12,13) |
| InChIKey | DPHIDWXLTTYHNP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|